C22H20ClN3S — CID 143423117
N-(7-chloronaphthalen-2-yl)sulfanyl-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-amine (PubChem CID 143423117) has the molecular formula C22H20ClN3S and a molecular weight of 393.94 g/mol. Its IUPAC name is N-(7-chloronaphthalen-2-yl)sulfanyl-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-amine.
| Compound Name | N-(7-chloronaphthalen-2-yl)sulfanyl-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-amine |
|---|---|
| PubChem CID | 143423117 |
| Molecular Formula | C22H20ClN3S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-(7-chloronaphthalen-2-yl)sulfanyl-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-amine |
| SMILES | CN1CCc2c([nH]c3ccc(NSc4ccc5ccc(Cl)cc5c4)cc23)C1 |
| InChI | InChI=1S/C22H20ClN3S/c1-26-9-8-19-20-12-17(5-7-21(20)24-22(19)13-26)25-27-18-6-3-14-2-4-16(23)10-15(14)11-18/h2-7,10-12,24-25H,8-9,13H2,1H3 |
| InChIKey | DZIPZZZRPGQOBR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|