About (3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane
(3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane (PubChem CID 143423152) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is (3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane.
Molecular Properties
| Compound Name | (3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane |
| PubChem CID | 143423152 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane |
| SMILES | C/C=C\C=C1\COC2(CCNCC2)\C1=C\C.CC |
| InChI | InChI=1S/C14H21NO.C2H6/c1-3-5-6-12-11-16-14(13(12)4-2)7-9-15-10-8-14;1-2/h3-6,15H,7-11H2,1-2H3;1-2H3/b5-3-,12-6-,13-4+; |
| InChIKey | QJPNKIOCVRCQKK-DGVFSXBRSA-N |
| XLogP | 3.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane?
The IUPAC name of (3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane (CID 143423152) is (3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane.
What is the SMILES notation for (3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane?
The canonical SMILES for (3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane is C/C=C\C=C1\COC2(CCNCC2)\C1=C\C.CC.
What is the InChIKey of (3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane?
The InChIKey is QJPNKIOCVRCQKK-DGVFSXBRSA-N. The full InChI is InChI=1S/C14H21NO.C2H6/c1-3-5-6-12-11-16-14(13(12)4-2)7-9-15-10-8-14;1-2/h3-6,15H,7-11H2,1-2H3;1-2H3/b5-3-,12-6-,13-4+;.
What are the key properties of (3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane?
(3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane has a molecular weight of 249.40 g/mol, XLogP of 3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-1-oxa-8-azaspiro[4.5]decane;ethane is sourced from PubChem (CID 143423152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).