C18H22F2N4O2S2 — CID 143423388
4-[6-(azetidin-1-ylsulfanylamino)-2-[(2,3-difluorophenyl)methylsulfanyl]pyrimidin-4-yl]butane-1,2-diol (PubChem CID 143423388) has the molecular formula C18H22F2N4O2S2 and a molecular weight of 428.53 g/mol. Its IUPAC name is 4-[6-(azetidin-1-ylsulfanylamino)-2-[(2,3-difluorophenyl)methylsulfanyl]pyrimidin-4-yl]butane-1,2-diol.
| Compound Name | 4-[6-(azetidin-1-ylsulfanylamino)-2-[(2,3-difluorophenyl)methylsulfanyl]pyrimidin-4-yl]butane-1,2-diol |
|---|---|
| PubChem CID | 143423388 |
| Molecular Formula | C18H22F2N4O2S2 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-[6-(azetidin-1-ylsulfanylamino)-2-[(2,3-difluorophenyl)methylsulfanyl]pyrimidin-4-yl]butane-1,2-diol |
| SMILES | OCC(O)CCc1cc(NSN2CCC2)nc(SCc2cccc(F)c2F)n1 |
| InChI | InChI=1S/C18H22F2N4O2S2/c19-15-4-1-3-12(17(15)20)11-27-18-21-13(5-6-14(26)10-25)9-16(22-18)23-28-24-7-2-8-24/h1,3-4,9,14,25-26H,2,5-8,10-11H2,(H,21,22,23) |
| InChIKey | ADDNRNVNOVGXMB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|