C17H19F2N5O2S2 — CID 143423410
N-(azetidin-1-ylsulfanyl)-2-[(2,3-difluorophenyl)methylsulfanyl]-6-[[(4S)-1,2-oxazolidin-4-yl]oxy]pyrimidin-4-amine (PubChem CID 143423410) has the molecular formula C17H19F2N5O2S2 and a molecular weight of 427.50 g/mol. Its IUPAC name is N-(azetidin-1-ylsulfanyl)-2-[(2,3-difluorophenyl)methylsulfanyl]-6-[[(4S)-1,2-oxazolidin-4-yl]oxy]pyrimidin-4-amine.
| Compound Name | N-(azetidin-1-ylsulfanyl)-2-[(2,3-difluorophenyl)methylsulfanyl]-6-[[(4S)-1,2-oxazolidin-4-yl]oxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143423410 |
| Molecular Formula | C17H19F2N5O2S2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | N-(azetidin-1-ylsulfanyl)-2-[(2,3-difluorophenyl)methylsulfanyl]-6-[[(4S)-1,2-oxazolidin-4-yl]oxy]pyrimidin-4-amine |
| SMILES | Fc1cccc(CSc2nc(NSN3CCC3)cc(O[C@H]3CNOC3)n2)c1F |
| InChI | InChI=1S/C17H19F2N5O2S2/c18-13-4-1-3-11(16(13)19)10-27-17-21-14(23-28-24-5-2-6-24)7-15(22-17)26-12-8-20-25-9-12/h1,3-4,7,12,20H,2,5-6,8-10H2,(H,21,22,23)/t12-/m0/s1 |
| InChIKey | WJCXFLUTJVGIHR-LBPRGKRZSA-N |
| XLogP | 3.01 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|