C13H19NO — CID 143423489
1-(3,4-dihydro-2H-quinolin-1-yl)ethanone;ethane (PubChem CID 143423489) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)ethanone;ethane.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)ethanone;ethane |
|---|---|
| PubChem CID | 143423489 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)ethanone;ethane |
| SMILES | CC.CC(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C11H13NO.C2H6/c1-9(13)12-8-4-6-10-5-2-3-7-11(10)12;1-2/h2-3,5,7H,4,6,8H2,1H3;1-2H3 |
| InChIKey | QPYBGUWJQFCGFR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |