C9H10F6 — CID 143423898
ethane;1,1,2,2,3,3-hexafluoro-4,5-dimethylidenecyclopentane (PubChem CID 143423898) has the molecular formula C9H10F6 and a molecular weight of 232.17 g/mol. Its IUPAC name is ethane;1,1,2,2,3,3-hexafluoro-4,5-dimethylidenecyclopentane.
| Compound Name | ethane;1,1,2,2,3,3-hexafluoro-4,5-dimethylidenecyclopentane |
|---|---|
| PubChem CID | 143423898 |
| Molecular Formula | C9H10F6 |
| Molecular Weight | 232.17 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | ethane;1,1,2,2,3,3-hexafluoro-4,5-dimethylidenecyclopentane |
| SMILES | C=C1C(=C)C(F)(F)C(F)(F)C1(F)F.CC |
| InChI | InChI=1S/C7H4F6.C2H6/c1-3-4(2)6(10,11)7(12,13)5(3,8)9;1-2/h1-2H2;1-2H3 |
| InChIKey | NJBODEJZQYDBMX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.17 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|