About methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate
methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate (PubChem CID 143424302) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 143424302 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate |
| SMILES | C=C(C)COC1=CCCC(C(=O)OC)=C1 |
| InChI | InChI=1S/C12H16O3/c1-9(2)8-15-11-6-4-5-10(7-11)12(13)14-3/h6-7H,1,4-5,8H2,2-3H3 |
| InChIKey | JVEZCAXCTOJESY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate (CID 143424302) is methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate is C=C(C)COC1=CCCC(C(=O)OC)=C1.
What is the InChIKey of methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate?
The InChIKey is JVEZCAXCTOJESY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-9(2)8-15-11-6-4-5-10(7-11)12(13)14-3/h6-7H,1,4-5,8H2,2-3H3.
What are the key properties of methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate?
methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate has a molecular weight of 208.26 g/mol, XLogP of 2.36, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2-methylprop-2-enoxy)cyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 143424302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).