C24H23F3N4O2 — CID 143424523
N-amino-N'-methyl-9-[8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-ylidene]xanthene-3-carboximidamide (PubChem CID 143424523) has the molecular formula C24H23F3N4O2 and a molecular weight of 456.47 g/mol. Its IUPAC name is N-amino-N'-methyl-9-[8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-ylidene]xanthene-3-carboximidamide.
| Compound Name | N-amino-N'-methyl-9-[8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-ylidene]xanthene-3-carboximidamide |
|---|---|
| PubChem CID | 143424523 |
| Molecular Formula | C24H23F3N4O2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-amino-N'-methyl-9-[8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-ylidene]xanthene-3-carboximidamide |
| SMILES | C/N=C(\NN)c1ccc2c(c1)Oc1ccccc1C2=C1CC2CCC(C1)N2C(=O)C(F)(F)F |
| InChI | InChI=1S/C24H23F3N4O2/c1-29-22(30-28)13-6-9-18-20(12-13)33-19-5-3-2-4-17(19)21(18)14-10-15-7-8-16(11-14)31(15)23(32)24(25,26)27/h2-6,9,12,15-16H,7-8,10-11,28H2,1H3,(H,29,30) |
| InChIKey | DBRUENPGBOAVAF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|