C25H27F3N4O2 — CID 143424549
N'-amino-9-[8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-ylidene]xanthene-3-carboximidamide;ethane (PubChem CID 143424549) has the molecular formula C25H27F3N4O2 and a molecular weight of 472.51 g/mol. Its IUPAC name is N'-amino-9-[8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-ylidene]xanthene-3-carboximidamide;ethane.
| Compound Name | N'-amino-9-[8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-ylidene]xanthene-3-carboximidamide;ethane |
|---|---|
| PubChem CID | 143424549 |
| Molecular Formula | C25H27F3N4O2 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N'-amino-9-[8-(2,2,2-trifluoroacetyl)-8-azabicyclo[3.2.1]octan-3-ylidene]xanthene-3-carboximidamide;ethane |
| SMILES | CC.N/N=C(\N)c1ccc2c(c1)Oc1ccccc1C2=C1CC2CCC(C1)N2C(=O)C(F)(F)F |
| InChI | InChI=1S/C23H21F3N4O2.C2H6/c24-23(25,26)22(31)30-14-6-7-15(30)10-13(9-14)20-16-3-1-2-4-18(16)32-19-11-12(21(27)29-28)5-8-17(19)20;1-2/h1-5,8,11,14-15H,6-7,9-10,28H2,(H2,27,29);1-2H3 |
| InChIKey | SUUISVZISYSCAK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|