About cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine
cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine (PubChem CID 143424579) has the molecular formula C18H36AlNO
and a molecular weight of 309.47 g/mol. Its IUPAC name is cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine.
Molecular Properties
| Compound Name | cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine |
| PubChem CID | 143424579 |
| Molecular Formula | C18H36AlNO |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.26 |
| IUPAC Name | cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine |
| SMILES | C1CCCCC1.CC[Al](CC)OC1CCCCC1/C=N/C |
| InChI | InChI=1S/C8H14NO.C6H12.2C2H5.Al/c1-9-6-7-4-2-3-5-8(7)10;1-2-4-6-5-3-1;2*1-2;/h6-8H,2-5H2,1H3;1-6H2;2*1H2,2H3;/q-1;;;;+1/b9-6+;;;; |
| InChIKey | QJFXHNZRCRFXJX-MPMAQEBPSA-N |
| XLogP | 5.63 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine?
The IUPAC name of cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine (CID 143424579) is cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine.
What is the SMILES notation for cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine?
The canonical SMILES for cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine is C1CCCCC1.CC[Al](CC)OC1CCCCC1/C=N/C.
What is the InChIKey of cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine?
The InChIKey is QJFXHNZRCRFXJX-MPMAQEBPSA-N. The full InChI is InChI=1S/C8H14NO.C6H12.2C2H5.Al/c1-9-6-7-4-2-3-5-8(7)10;1-2-4-6-5-3-1;2*1-2;/h6-8H,2-5H2,1H3;1-6H2;2*1H2,2H3;/q-1;;;;+1/b9-6+;;;;.
What are the key properties of cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine?
cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine has a molecular weight of 309.47 g/mol, XLogP of 5.63, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;1-(2-diethylalumanyloxycyclohexyl)-N-methylmethanimine is sourced from PubChem (CID 143424579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).