C24H25NO5S2 — CID 143424889
3-[1-[(2Z)-3-[(E)-but-2-en-2-yl]oxypenta-2,4-dien-2-yl]sulfonyl-5-thiophen-3-ylindol-3-yl]propanoic acid (PubChem CID 143424889) has the molecular formula C24H25NO5S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is 3-[1-[(2Z)-3-[(E)-but-2-en-2-yl]oxypenta-2,4-dien-2-yl]sulfonyl-5-thiophen-3-ylindol-3-yl]propanoic acid.
| Compound Name | 3-[1-[(2Z)-3-[(E)-but-2-en-2-yl]oxypenta-2,4-dien-2-yl]sulfonyl-5-thiophen-3-ylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 143424889 |
| Molecular Formula | C24H25NO5S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 3-[1-[(2Z)-3-[(E)-but-2-en-2-yl]oxypenta-2,4-dien-2-yl]sulfonyl-5-thiophen-3-ylindol-3-yl]propanoic acid |
| SMILES | C=C/C(O/C(C)=C/C)=C(\C)S(=O)(=O)n1cc(CCC(=O)O)c2cc(-c3ccsc3)ccc21 |
| InChI | InChI=1S/C24H25NO5S2/c1-5-16(3)30-23(6-2)17(4)32(28,29)25-14-19(8-10-24(26)27)21-13-18(7-9-22(21)25)20-11-12-31-15-20/h5-7,9,11-15H,2,8,10H2,1,3-4H3,(H,26,27)/b16-5+,23-17- |
| InChIKey | DWFYTCHHYUKGDM-ADNPUGOSSA-N |
| XLogP | 5.92 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|