C21H27NO5S — CID 143424941
3-[6-ethoxy-1-[(2Z,4Z)-4-methylhepta-2,4-dienyl]sulfonylindol-3-yl]propanoic acid (PubChem CID 143424941) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is 3-[6-ethoxy-1-[(2Z,4Z)-4-methylhepta-2,4-dienyl]sulfonylindol-3-yl]propanoic acid.
| Compound Name | 3-[6-ethoxy-1-[(2Z,4Z)-4-methylhepta-2,4-dienyl]sulfonylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 143424941 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 3-[6-ethoxy-1-[(2Z,4Z)-4-methylhepta-2,4-dienyl]sulfonylindol-3-yl]propanoic acid |
| SMILES | CC/C=C(C)\C=C/CS(=O)(=O)n1cc(CCC(=O)O)c2ccc(OCC)cc21 |
| InChI | InChI=1S/C21H27NO5S/c1-4-7-16(3)8-6-13-28(25,26)22-15-17(9-12-21(23)24)19-11-10-18(27-5-2)14-20(19)22/h6-8,10-11,14-15H,4-5,9,12-13H2,1-3H3,(H,23,24)/b8-6-,16-7- |
| InChIKey | FTSCTIPZUDUZRC-QTEXKWGPSA-N |
| XLogP | 4.15 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|