C11H22O2S — CID 143427722
ethane;4-ethylsulfanyl-5,6-dimethyloxan-2-one (PubChem CID 143427722) has the molecular formula C11H22O2S and a molecular weight of 218.36 g/mol. Its IUPAC name is ethane;4-ethylsulfanyl-5,6-dimethyloxan-2-one.
| Compound Name | ethane;4-ethylsulfanyl-5,6-dimethyloxan-2-one |
|---|---|
| PubChem CID | 143427722 |
| Molecular Formula | C11H22O2S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | ethane;4-ethylsulfanyl-5,6-dimethyloxan-2-one |
| SMILES | CC.CCSC1CC(=O)OC(C)C1C |
| InChI | InChI=1S/C9H16O2S.C2H6/c1-4-12-8-5-9(10)11-7(3)6(8)2;1-2/h6-8H,4-5H2,1-3H3;1-2H3 |
| InChIKey | DSBWXCRCRCFOEG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |