C9H16O2S — CID 143427723
4-ethylsulfanyl-5,6-dimethyloxan-2-one (PubChem CID 143427723) has the molecular formula C9H16O2S and a molecular weight of 188.29 g/mol. Its IUPAC name is 4-ethylsulfanyl-5,6-dimethyloxan-2-one.
| Compound Name | 4-ethylsulfanyl-5,6-dimethyloxan-2-one |
|---|---|
| PubChem CID | 143427723 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 4-ethylsulfanyl-5,6-dimethyloxan-2-one |
| SMILES | CCSC1CC(=O)OC(C)C1C |
| InChI | InChI=1S/C9H16O2S/c1-4-12-8-5-9(10)11-7(3)6(8)2/h6-8H,4-5H2,1-3H3 |
| InChIKey | PMBLEUKNHAPQMJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |