C35H58N8O4 — CID 143428621
methyl 2-[3-[[2-[4-[7-[[6-amino-2-butoxy-5-(methylideneamino)pyrimidin-4-yl]-(methoxymethyl)amino]heptyl]piperazin-1-yl]ethyl-methylamino]methyl]phenyl]acetate (PubChem CID 143428621) has the molecular formula C35H58N8O4 and a molecular weight of 654.90 g/mol. Its IUPAC name is methyl 2-[3-[[2-[4-[7-[[6-amino-2-butoxy-5-(methylideneamino)pyrimidin-4-yl]-(methoxymethyl)amino]heptyl]piperazin-1-yl]ethyl-methylamino]methyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[[2-[4-[7-[[6-amino-2-butoxy-5-(methylideneamino)pyrimidin-4-yl]-(methoxymethyl)amino]heptyl]piperazin-1-yl]ethyl-methylamino]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 143428621 |
| Molecular Formula | C35H58N8O4 |
| Molecular Weight | 654.90 g/mol |
| Exact Mass | 654.46 |
| IUPAC Name | methyl 2-[3-[[2-[4-[7-[[6-amino-2-butoxy-5-(methylideneamino)pyrimidin-4-yl]-(methoxymethyl)amino]heptyl]piperazin-1-yl]ethyl-methylamino]methyl]phenyl]acetate |
| SMILES | C=Nc1c(N)nc(OCCCC)nc1N(CCCCCCCN1CCN(CCN(C)Cc2cccc(CC(=O)OC)c2)CC1)COC |
| InChI | InChI=1S/C35H58N8O4/c1-6-7-24-47-35-38-33(36)32(37-2)34(39-35)43(28-45-4)17-12-10-8-9-11-16-41-20-22-42(23-21-41)19-18-40(3)27-30-15-13-14-29(25-30)26-31(44)46-5/h13-15,25H,2,6-12,16-24,26-28H2,1,3-5H3,(H2,36,38,39) |
| InChIKey | DAAVJBVHMGBWKQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.90 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|