2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen

C9H14N2 — CID 143430257

IUPAC2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen
SMILESC/C=C(/C)c1cnc(C)cn1.[H][H]
InChIInChI=1S/C9H12N2.H2/c1-4-7(2)9-6-10-8(3)5-11-9;/h4-6H,1-3H3;1H/b7-4-;
InChIKeyXWGGIWDYBKVKIJ-ZULQGGHCSA-N
MW150.22 g/mol
LogP2.45
Rot. Bonds1

About 2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen

2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen (PubChem CID 143430257) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen.

Molecular Properties

Compound Name2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen
PubChem CID143430257
Molecular FormulaC9H14N2
Molecular Weight150.22 g/mol
Exact Mass150.12
IUPAC Name2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen
SMILESC/C=C(/C)c1cnc(C)cn1.[H][H]
InChIInChI=1S/C9H12N2.H2/c1-4-7(2)9-6-10-8(3)5-11-9;/h4-6H,1-3H3;1H/b7-4-;
InChIKeyXWGGIWDYBKVKIJ-ZULQGGHCSA-N
XLogP2.45
TPSA25.78 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.22
LogP ≤ 52.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen?
The IUPAC name of 2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen (CID 143430257) is 2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen.
What is the SMILES notation for 2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen?
The canonical SMILES for 2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen is C/C=C(/C)c1cnc(C)cn1.[H][H].
What is the InChIKey of 2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen?
The InChIKey is XWGGIWDYBKVKIJ-ZULQGGHCSA-N. The full InChI is InChI=1S/C9H12N2.H2/c1-4-7(2)9-6-10-8(3)5-11-9;/h4-6H,1-3H3;1H/b7-4-;.
What are the key properties of 2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen?
2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen has a molecular weight of 150.22 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-but-2-en-2-yl]-5-methylpyrazine;molecular hydrogen is sourced from PubChem (CID 143430257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).