C28H34N4O6 — CID 143430445
2-[2,6-dimethyl-4-[[[methyl-(methylideneamino)carbamoyl]oxymethyl-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]amino]methyl]phenoxy]-2-methylpropanoic acid (PubChem CID 143430445) has the molecular formula C28H34N4O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is 2-[2,6-dimethyl-4-[[[methyl-(methylideneamino)carbamoyl]oxymethyl-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]amino]methyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[2,6-dimethyl-4-[[[methyl-(methylideneamino)carbamoyl]oxymethyl-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]amino]methyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 143430445 |
| Molecular Formula | C28H34N4O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | 2-[2,6-dimethyl-4-[[[methyl-(methylideneamino)carbamoyl]oxymethyl-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]amino]methyl]phenoxy]-2-methylpropanoic acid |
| SMILES | C=NN(C)C(=O)OCN(Cc1cc(C)c(OC(C)(C)C(=O)O)c(C)c1)Cc1nc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C28H34N4O6/c1-18-13-21(14-19(2)24(18)38-28(4,5)26(33)34)15-32(17-36-27(35)31(7)29-6)16-23-20(3)37-25(30-23)22-11-9-8-10-12-22/h8-14H,6,15-17H2,1-5,7H3,(H,33,34) |
| InChIKey | AOSTYWJFJCNCKC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|