C19H34F3N3O2 — CID 143431640
(3E)-3-(2-methoxyethoxy)hexa-1,3,5-triene;2,2,2-trifluoro-N-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]ethanamine (PubChem CID 143431640) has the molecular formula C19H34F3N3O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is (3E)-3-(2-methoxyethoxy)hexa-1,3,5-triene;2,2,2-trifluoro-N-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]ethanamine.
| Compound Name | (3E)-3-(2-methoxyethoxy)hexa-1,3,5-triene;2,2,2-trifluoro-N-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 143431640 |
| Molecular Formula | C19H34F3N3O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | (3E)-3-(2-methoxyethoxy)hexa-1,3,5-triene;2,2,2-trifluoro-N-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]ethanamine |
| SMILES | C=C/C=C(\C=C)OCCOC.CN1CCN(CCN(C)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H20F3N3.C9H14O2/c1-14-3-6-16(7-4-14)8-5-15(2)9-10(11,12)13;1-4-6-9(5-2)11-8-7-10-3/h3-9H2,1-2H3;4-6H,1-2,7-8H2,3H3/b;9-6+ |
| InChIKey | UVICBEIHGNTZSX-RRJFPGPQSA-N |
| XLogP | 2.63 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|