C19H41FN2O2 — CID 143431662
ethane;N'-[(2E,4E)-2-fluoro-4-(2-methoxyethoxy)hexa-2,4-dienyl]-N,N,N'-trimethylethane-1,2-diamine;propane (PubChem CID 143431662) has the molecular formula C19H41FN2O2 and a molecular weight of 348.55 g/mol. Its IUPAC name is ethane;N'-[(2E,4E)-2-fluoro-4-(2-methoxyethoxy)hexa-2,4-dienyl]-N,N,N'-trimethylethane-1,2-diamine;propane.
| Compound Name | ethane;N'-[(2E,4E)-2-fluoro-4-(2-methoxyethoxy)hexa-2,4-dienyl]-N,N,N'-trimethylethane-1,2-diamine;propane |
|---|---|
| PubChem CID | 143431662 |
| Molecular Formula | C19H41FN2O2 |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.32 |
| IUPAC Name | ethane;N'-[(2E,4E)-2-fluoro-4-(2-methoxyethoxy)hexa-2,4-dienyl]-N,N,N'-trimethylethane-1,2-diamine;propane |
| SMILES | C/C=C(\C=C(\F)CN(C)CCN(C)C)OCCOC.CC.CCC |
| InChI | InChI=1S/C14H27FN2O2.C3H8.C2H6/c1-6-14(19-10-9-18-5)11-13(15)12-17(4)8-7-16(2)3;1-3-2;1-2/h6,11H,7-10,12H2,1-5H3;3H2,1-2H3;1-2H3/b13-11+,14-6+;; |
| InChIKey | GRNQWPHLFMPPGA-BIJOUKIDSA-N |
| XLogP | 4.34 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|