About 3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole
3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole (PubChem CID 14343206) has the molecular formula C10H7N3O4Se
and a molecular weight of 312.14 g/mol. Its IUPAC name is 3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole.
Molecular Properties
| Compound Name | 3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole |
| PubChem CID | 14343206 |
| Molecular Formula | C10H7N3O4Se |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | 3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole |
| SMILES | Cc1n[se]c(-c2ccc([N+](=O)[O-])cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7N3O4Se/c1-6-9(13(16)17)10(18-11-6)7-2-4-8(5-3-7)12(14)15/h2-5H,1H3 |
| InChIKey | IOIWQYXOBDVXAX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole?
The IUPAC name of 3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole (CID 14343206) is 3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole.
What is the SMILES notation for 3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole?
The canonical SMILES for 3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole is Cc1n[se]c(-c2ccc([N+](=O)[O-])cc2)c1[N+](=O)[O-].
What is the InChIKey of 3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole?
The InChIKey is IOIWQYXOBDVXAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O4Se/c1-6-9(13(16)17)10(18-11-6)7-2-4-8(5-3-7)12(14)15/h2-5H,1H3.
What are the key properties of 3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole?
3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole has a molecular weight of 312.14 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-nitro-5-(4-nitrophenyl)-1,2-selenazole is sourced from PubChem (CID 14343206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).