About (3-propyl-1,3-thiazolidin-2-yl)methanediol
(3-propyl-1,3-thiazolidin-2-yl)methanediol (PubChem CID 143432464) has the molecular formula C7H15NO2S
and a molecular weight of 177.27 g/mol. Its IUPAC name is (3-propyl-1,3-thiazolidin-2-yl)methanediol.
Molecular Properties
| Compound Name | (3-propyl-1,3-thiazolidin-2-yl)methanediol |
| PubChem CID | 143432464 |
| Molecular Formula | C7H15NO2S |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (3-propyl-1,3-thiazolidin-2-yl)methanediol |
| SMILES | CCCN1CCSC1C(O)O |
| InChI | InChI=1S/C7H15NO2S/c1-2-3-8-4-5-11-6(8)7(9)10/h6-7,9-10H,2-5H2,1H3 |
| InChIKey | DKUFTHCCRZKKHX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3-propyl-1,3-thiazolidin-2-yl)methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propyl-1,3-thiazolidin-2-yl)methanediol?
The IUPAC name of (3-propyl-1,3-thiazolidin-2-yl)methanediol (CID 143432464) is (3-propyl-1,3-thiazolidin-2-yl)methanediol.
What is the SMILES notation for (3-propyl-1,3-thiazolidin-2-yl)methanediol?
The canonical SMILES for (3-propyl-1,3-thiazolidin-2-yl)methanediol is CCCN1CCSC1C(O)O.
What is the InChIKey of (3-propyl-1,3-thiazolidin-2-yl)methanediol?
The InChIKey is DKUFTHCCRZKKHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2S/c1-2-3-8-4-5-11-6(8)7(9)10/h6-7,9-10H,2-5H2,1H3.
What are the key properties of (3-propyl-1,3-thiazolidin-2-yl)methanediol?
(3-propyl-1,3-thiazolidin-2-yl)methanediol has a molecular weight of 177.27 g/mol, XLogP of 0.08, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propyl-1,3-thiazolidin-2-yl)methanediol is sourced from PubChem (CID 143432464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).