About 2-[2-cyanoethyl(propyl)amino]acetic acid;ethane
2-[2-cyanoethyl(propyl)amino]acetic acid;ethane (PubChem CID 143432477) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-[2-cyanoethyl(propyl)amino]acetic acid;ethane.
Molecular Properties
| Compound Name | 2-[2-cyanoethyl(propyl)amino]acetic acid;ethane |
| PubChem CID | 143432477 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2-[2-cyanoethyl(propyl)amino]acetic acid;ethane |
| SMILES | CC.CCCN(CCC#N)CC(=O)O |
| InChI | InChI=1S/C8H14N2O2.C2H6/c1-2-5-10(6-3-4-9)7-8(11)12;1-2/h2-3,5-7H2,1H3,(H,11,12);1-2H3 |
| InChIKey | BZXFUANVZGVGJB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-cyanoethyl(propyl)amino]acetic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-cyanoethyl(propyl)amino]acetic acid;ethane?
The IUPAC name of 2-[2-cyanoethyl(propyl)amino]acetic acid;ethane (CID 143432477) is 2-[2-cyanoethyl(propyl)amino]acetic acid;ethane.
What is the SMILES notation for 2-[2-cyanoethyl(propyl)amino]acetic acid;ethane?
The canonical SMILES for 2-[2-cyanoethyl(propyl)amino]acetic acid;ethane is CC.CCCN(CCC#N)CC(=O)O.
What is the InChIKey of 2-[2-cyanoethyl(propyl)amino]acetic acid;ethane?
The InChIKey is BZXFUANVZGVGJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2.C2H6/c1-2-5-10(6-3-4-9)7-8(11)12;1-2/h2-3,5-7H2,1H3,(H,11,12);1-2H3.
What are the key properties of 2-[2-cyanoethyl(propyl)amino]acetic acid;ethane?
2-[2-cyanoethyl(propyl)amino]acetic acid;ethane has a molecular weight of 200.28 g/mol, XLogP of 1.72, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-cyanoethyl(propyl)amino]acetic acid;ethane is sourced from PubChem (CID 143432477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).