About ethane;N,2,6-trimethylmorpholine-4-carboxamide
ethane;N,2,6-trimethylmorpholine-4-carboxamide (PubChem CID 143432514) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is ethane;N,2,6-trimethylmorpholine-4-carboxamide.
Molecular Properties
| Compound Name | ethane;N,2,6-trimethylmorpholine-4-carboxamide |
| PubChem CID | 143432514 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | ethane;N,2,6-trimethylmorpholine-4-carboxamide |
| SMILES | CC.CNC(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C8H16N2O2.C2H6/c1-6-4-10(8(11)9-3)5-7(2)12-6;1-2/h6-7H,4-5H2,1-3H3,(H,9,11);1-2H3 |
| InChIKey | OPIXCYNSJXKJGI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N,2,6-trimethylmorpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N,2,6-trimethylmorpholine-4-carboxamide?
The IUPAC name of ethane;N,2,6-trimethylmorpholine-4-carboxamide (CID 143432514) is ethane;N,2,6-trimethylmorpholine-4-carboxamide.
What is the SMILES notation for ethane;N,2,6-trimethylmorpholine-4-carboxamide?
The canonical SMILES for ethane;N,2,6-trimethylmorpholine-4-carboxamide is CC.CNC(=O)N1CC(C)OC(C)C1.
What is the InChIKey of ethane;N,2,6-trimethylmorpholine-4-carboxamide?
The InChIKey is OPIXCYNSJXKJGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2.C2H6/c1-6-4-10(8(11)9-3)5-7(2)12-6;1-2/h6-7H,4-5H2,1-3H3,(H,9,11);1-2H3.
What are the key properties of ethane;N,2,6-trimethylmorpholine-4-carboxamide?
ethane;N,2,6-trimethylmorpholine-4-carboxamide has a molecular weight of 202.30 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N,2,6-trimethylmorpholine-4-carboxamide is sourced from PubChem (CID 143432514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).