About ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid
ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid (PubChem CID 143432700) has the molecular formula C11H24F3NO2
and a molecular weight of 259.31 g/mol. Its IUPAC name is ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid.
Molecular Properties
| Compound Name | ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid |
| PubChem CID | 143432700 |
| Molecular Formula | C11H24F3NO2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid |
| SMILES | CC.CC.CCCNC(CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NO2.2C2H6/c1-2-3-11-5(4-6(12)13)7(8,9)10;2*1-2/h5,11H,2-4H2,1H3,(H,12,13);2*1-2H3 |
| InChIKey | DMKRWZQAOLGGIL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid?
The IUPAC name of ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid (CID 143432700) is ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid.
What is the SMILES notation for ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid?
The canonical SMILES for ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid is CC.CC.CCCNC(CC(=O)O)C(F)(F)F.
What is the InChIKey of ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid?
The InChIKey is DMKRWZQAOLGGIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3NO2.2C2H6/c1-2-3-11-5(4-6(12)13)7(8,9)10;2*1-2/h5,11H,2-4H2,1H3,(H,12,13);2*1-2H3.
What are the key properties of ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid?
ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid has a molecular weight of 259.31 g/mol, XLogP of 3.44, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4,4,4-trifluoro-3-(propylamino)butanoic acid is sourced from PubChem (CID 143432700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).