About ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol
ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol (PubChem CID 143432758) has the molecular formula C12H31NO2S
and a molecular weight of 253.45 g/mol. Its IUPAC name is ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol.
Molecular Properties
| Compound Name | ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol |
| PubChem CID | 143432758 |
| Molecular Formula | C12H31NO2S |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.21 |
| IUPAC Name | ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol |
| SMILES | CC.CC.CCCN(CCSC)CC(O)O |
| InChI | InChI=1S/C8H19NO2S.2C2H6/c1-3-4-9(5-6-12-2)7-8(10)11;2*1-2/h8,10-11H,3-7H2,1-2H3;2*1-2H3 |
| InChIKey | MNVXFTCMYXXYPP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol?
The IUPAC name of ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol (CID 143432758) is ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol.
What is the SMILES notation for ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol?
The canonical SMILES for ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol is CC.CC.CCCN(CCSC)CC(O)O.
What is the InChIKey of ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol?
The InChIKey is MNVXFTCMYXXYPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO2S.2C2H6/c1-3-4-9(5-6-12-2)7-8(10)11;2*1-2/h8,10-11H,3-7H2,1-2H3;2*1-2H3.
What are the key properties of ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol?
ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol has a molecular weight of 253.45 g/mol, XLogP of 2.42, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[2-methylsulfanylethyl(propyl)amino]ethane-1,1-diol is sourced from PubChem (CID 143432758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).