C29H28F3NO2 — CID 143433107
4-[4-[2-methyl-3-phenyl-5-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-2-yl]pyrrol-1-yl]phenyl]butanoic acid (PubChem CID 143433107) has the molecular formula C29H28F3NO2 and a molecular weight of 479.54 g/mol. Its IUPAC name is 4-[4-[2-methyl-3-phenyl-5-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-2-yl]pyrrol-1-yl]phenyl]butanoic acid.
| Compound Name | 4-[4-[2-methyl-3-phenyl-5-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-2-yl]pyrrol-1-yl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 143433107 |
| Molecular Formula | C29H28F3NO2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 4-[4-[2-methyl-3-phenyl-5-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-2-yl]pyrrol-1-yl]phenyl]butanoic acid |
| SMILES | C=C/C(=C\C=C(/C)c1cc(-c2ccccc2)c(C)n1-c1ccc(CCCC(=O)O)cc1)C(F)(F)F |
| InChI | InChI=1S/C29H28F3NO2/c1-4-24(29(30,31)32)16-13-20(2)27-19-26(23-10-6-5-7-11-23)21(3)33(27)25-17-14-22(15-18-25)9-8-12-28(34)35/h4-7,10-11,13-19H,1,8-9,12H2,2-3H3,(H,34,35)/b20-13+,24-16+ |
| InChIKey | UIFZZXUBNRFMNI-NWLPHCLUSA-N |
| XLogP | 7.94 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|