About 5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene
5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene (PubChem CID 143433111) has the molecular formula C26H26ClNO2
and a molecular weight of 419.95 g/mol. Its IUPAC name is 5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene.
Molecular Properties
| Compound Name | 5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene |
| PubChem CID | 143433111 |
| Molecular Formula | C26H26ClNO2 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene |
| SMILES | C/C=C\C.C=C/C=C/c1cc(-c2ccccc2)c(C)n1-c1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C22H18ClNO2.C4H8/c1-3-4-10-17-13-19(16-8-6-5-7-9-16)15(2)24(17)18-11-12-21(23)20(14-18)22(25)26;1-3-4-2/h3-14H,1H2,2H3,(H,25,26);3-4H,1-2H3/b10-4+;4-3- |
| InChIKey | GTFNOAQCWXWZAP-ANVJBNJKSA-N |
| XLogP | 7.59 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene?
The IUPAC name of 5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene (CID 143433111) is 5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene.
What is the SMILES notation for 5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene?
The canonical SMILES for 5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene is C/C=C\C.C=C/C=C/c1cc(-c2ccccc2)c(C)n1-c1ccc(Cl)c(C(=O)O)c1.
What is the InChIKey of 5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene?
The InChIKey is GTFNOAQCWXWZAP-ANVJBNJKSA-N. The full InChI is InChI=1S/C22H18ClNO2.C4H8/c1-3-4-10-17-13-19(16-8-6-5-7-9-16)15(2)24(17)18-11-12-21(23)20(14-18)22(25)26;1-3-4-2/h3-14H,1H2,2H3,(H,25,26);3-4H,1-2H3/b10-4+;4-3-.
What are the key properties of 5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene?
5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene has a molecular weight of 419.95 g/mol, XLogP of 7.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[(1E)-buta-1,3-dienyl]-2-methyl-3-phenylpyrrol-1-yl]-2-chlorobenzoic acid;(Z)-but-2-ene is sourced from PubChem (CID 143433111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).