C28H22F3NO2 — CID 143433130
3-[2-but-3-enyl-3-phenyl-5-[4-(trifluoromethyl)phenyl]pyrrol-1-yl]benzoic acid (PubChem CID 143433130) has the molecular formula C28H22F3NO2 and a molecular weight of 461.48 g/mol. Its IUPAC name is 3-[2-but-3-enyl-3-phenyl-5-[4-(trifluoromethyl)phenyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 3-[2-but-3-enyl-3-phenyl-5-[4-(trifluoromethyl)phenyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 143433130 |
| Molecular Formula | C28H22F3NO2 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 3-[2-but-3-enyl-3-phenyl-5-[4-(trifluoromethyl)phenyl]pyrrol-1-yl]benzoic acid |
| SMILES | C=CCCc1c(-c2ccccc2)cc(-c2ccc(C(F)(F)F)cc2)n1-c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C28H22F3NO2/c1-2-3-12-25-24(19-8-5-4-6-9-19)18-26(20-13-15-22(16-14-20)28(29,30)31)32(25)23-11-7-10-21(17-23)27(33)34/h2,4-11,13-18H,1,3,12H2,(H,33,34) |
| InChIKey | UCFULQWOZGIRLB-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|