About (5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal
(5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal (PubChem CID 143433196) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is (5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal.
Molecular Properties
| Compound Name | (5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal |
| PubChem CID | 143433196 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal |
| SMILES | CCN(C)C(C)/C=C\C=C/CCCC=O |
| InChI | InChI=1S/C13H23NO/c1-4-14(3)13(2)11-9-7-5-6-8-10-12-15/h5,7,9,11-13H,4,6,8,10H2,1-3H3/b7-5-,11-9- |
| InChIKey | RYRDRGJXUCDFBS-CXHWBCNXSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal?
The IUPAC name of (5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal (CID 143433196) is (5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal.
What is the SMILES notation for (5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal?
The canonical SMILES for (5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal is CCN(C)C(C)/C=C\C=C/CCCC=O.
What is the InChIKey of (5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal?
The InChIKey is RYRDRGJXUCDFBS-CXHWBCNXSA-N. The full InChI is InChI=1S/C13H23NO/c1-4-14(3)13(2)11-9-7-5-6-8-10-12-15/h5,7,9,11-13H,4,6,8,10H2,1-3H3/b7-5-,11-9-.
What are the key properties of (5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal?
(5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal has a molecular weight of 209.33 g/mol, XLogP of 2.81, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,7Z)-9-[ethyl(methyl)amino]deca-5,7-dienal is sourced from PubChem (CID 143433196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).