C10H13BN2O4 — CID 143433345
4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-3-nitroaniline (PubChem CID 143433345) has the molecular formula C10H13BN2O4 and a molecular weight of 236.04 g/mol. Its IUPAC name is 4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-3-nitroaniline.
| Compound Name | 4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-3-nitroaniline |
|---|---|
| PubChem CID | 143433345 |
| Molecular Formula | C10H13BN2O4 |
| Molecular Weight | 236.04 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-3-nitroaniline |
| SMILES | CC1(C)COB(c2ccc(N)cc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C10H13BN2O4/c1-10(2)6-16-11(17-10)8-4-3-7(12)5-9(8)13(14)15/h3-5H,6,12H2,1-2H3 |
| InChIKey | QMPDMYRSSVAVIK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.04 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|