C12H7NO2S — CID 14343362
2-(furan-2-yl)thiopyrano[2,3-b]pyridin-4-one (PubChem CID 14343362) has the molecular formula C12H7NO2S and a molecular weight of 229.26 g/mol. Its IUPAC name is 2-(furan-2-yl)thiopyrano[2,3-b]pyridin-4-one.
| Compound Name | 2-(furan-2-yl)thiopyrano[2,3-b]pyridin-4-one |
|---|---|
| PubChem CID | 14343362 |
| Molecular Formula | C12H7NO2S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 2-(furan-2-yl)thiopyrano[2,3-b]pyridin-4-one |
| SMILES | O=c1cc(-c2ccco2)sc2ncccc12 |
| InChI | InChI=1S/C12H7NO2S/c14-9-7-11(10-4-2-6-15-10)16-12-8(9)3-1-5-13-12/h1-7H |
| InChIKey | BUEWRJWXUMVNAQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |