C21H32NO3Si+ — CID 143434023
6-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-1-hydroxy-2-phenyl-5,6,7,8-tetrahydropyrrolizin-4-ium-3-one (PubChem CID 143434023) has the molecular formula C21H32NO3Si+ and a molecular weight of 374.58 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-1-hydroxy-2-phenyl-5,6,7,8-tetrahydropyrrolizin-4-ium-3-one.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-1-hydroxy-2-phenyl-5,6,7,8-tetrahydropyrrolizin-4-ium-3-one |
|---|---|
| PubChem CID | 143434023 |
| Molecular Formula | C21H32NO3Si+ |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-1-hydroxy-2-phenyl-5,6,7,8-tetrahydropyrrolizin-4-ium-3-one |
| SMILES | CC[N+]12CC(O[Si](C)(C)C(C)(C)C)CC1C(O)=C(c1ccccc1)C2=O |
| InChI | InChI=1S/C21H31NO3Si/c1-7-22-14-16(25-26(5,6)21(2,3)4)13-17(22)19(23)18(20(22)24)15-11-9-8-10-12-15/h8-12,16-17H,7,13-14H2,1-6H3/p+1 |
| InChIKey | PNNHZKJPGMLHML-UHFFFAOYSA-O |
| XLogP | 4.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|