C33H45N7O7S — CID 143434350
2-anilino-5-[[4-[2-[bis(2-hydroxypropyl)amino]ethylsulfinyl]-2,5-dimethoxyphenyl]diazenyl]-6-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridine-3-carbonitrile (PubChem CID 143434350) has the molecular formula C33H45N7O7S and a molecular weight of 683.83 g/mol. Its IUPAC name is 2-anilino-5-[[4-[2-[bis(2-hydroxypropyl)amino]ethylsulfinyl]-2,5-dimethoxyphenyl]diazenyl]-6-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridine-3-carbonitrile.
| Compound Name | 2-anilino-5-[[4-[2-[bis(2-hydroxypropyl)amino]ethylsulfinyl]-2,5-dimethoxyphenyl]diazenyl]-6-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143434350 |
| Molecular Formula | C33H45N7O7S |
| Molecular Weight | 683.83 g/mol |
| Exact Mass | 683.31 |
| IUPAC Name | 2-anilino-5-[[4-[2-[bis(2-hydroxypropyl)amino]ethylsulfinyl]-2,5-dimethoxyphenyl]diazenyl]-6-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridine-3-carbonitrile |
| SMILES | COc1cc(S(=O)CCN(CC(C)O)CC(C)O)c(OC)cc1/N=N/c1c(NCCOCCO)nc(Nc2ccccc2)c(C#N)c1C |
| InChI | InChI=1S/C33H45N7O7S/c1-22(42)20-40(21-23(2)43)12-16-48(44)30-18-28(45-4)27(17-29(30)46-5)38-39-31-24(3)26(19-34)32(36-25-9-7-6-8-10-25)37-33(31)35-11-14-47-15-13-41/h6-10,17-18,22-23,41-43H,11-16,20-21H2,1-5H3,(H2,35,36,37)/b39-38+ |
| InChIKey | JZTQJRIJRRRFGF-YMZYAJTMSA-N |
| XLogP | 4.03 |
| TPSA | 194.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.83 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|