C18H20N6O2 — CID 143434669
3-[5-[1-(oxolane-2-carbonyl)piperidin-2-yl]tetrazol-2-yl]benzonitrile (PubChem CID 143434669) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 3-[5-[1-(oxolane-2-carbonyl)piperidin-2-yl]tetrazol-2-yl]benzonitrile.
| Compound Name | 3-[5-[1-(oxolane-2-carbonyl)piperidin-2-yl]tetrazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 143434669 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3-[5-[1-(oxolane-2-carbonyl)piperidin-2-yl]tetrazol-2-yl]benzonitrile |
| SMILES | N#Cc1cccc(-n2nnc(C3CCCCN3C(=O)C3CCCO3)n2)c1 |
| InChI | InChI=1S/C18H20N6O2/c19-12-13-5-3-6-14(11-13)24-21-17(20-22-24)15-7-1-2-9-23(15)18(25)16-8-4-10-26-16/h3,5-6,11,15-16H,1-2,4,7-10H2 |
| InChIKey | BHFPCLGUYDKUFP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |