C30H29F3N4O6 — CID 143434900
2-[3-amino-4-[1-[3,3,3-trifluoro-2-hydroxy-2-(6-nitro-1-phenylindol-3-yl)propyl]piperidin-4-yl]oxyphenyl]acetic acid (PubChem CID 143434900) has the molecular formula C30H29F3N4O6 and a molecular weight of 598.58 g/mol. Its IUPAC name is 2-[3-amino-4-[1-[3,3,3-trifluoro-2-hydroxy-2-(6-nitro-1-phenylindol-3-yl)propyl]piperidin-4-yl]oxyphenyl]acetic acid.
| Compound Name | 2-[3-amino-4-[1-[3,3,3-trifluoro-2-hydroxy-2-(6-nitro-1-phenylindol-3-yl)propyl]piperidin-4-yl]oxyphenyl]acetic acid |
|---|---|
| PubChem CID | 143434900 |
| Molecular Formula | C30H29F3N4O6 |
| Molecular Weight | 598.58 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | 2-[3-amino-4-[1-[3,3,3-trifluoro-2-hydroxy-2-(6-nitro-1-phenylindol-3-yl)propyl]piperidin-4-yl]oxyphenyl]acetic acid |
| SMILES | Nc1cc(CC(=O)O)ccc1OC1CCN(CC(O)(c2cn(-c3ccccc3)c3cc([N+](=O)[O-])ccc23)C(F)(F)F)CC1 |
| InChI | InChI=1S/C30H29F3N4O6/c31-30(32,33)29(40,18-35-12-10-22(11-13-35)43-27-9-6-19(14-25(27)34)15-28(38)39)24-17-36(20-4-2-1-3-5-20)26-16-21(37(41)42)7-8-23(24)26/h1-9,14,16-17,22,40H,10-13,15,18,34H2,(H,38,39) |
| InChIKey | SQEZMKLYFZTHNK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|