About acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal
acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal (PubChem CID 143435039) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal.
Molecular Properties
| Compound Name | acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal |
| PubChem CID | 143435039 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal |
| SMILES | C#C.C/C=C(C=O)\C=C/CCN |
| InChI | InChI=1S/C8H13NO.C2H2/c1-2-8(7-10)5-3-4-6-9;1-2/h2-3,5,7H,4,6,9H2,1H3;1-2H/b5-3-,8-2+; |
| InChIKey | YOPGXETVCWJNOA-UGKAMQEBSA-N |
| XLogP | 1.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal?
The IUPAC name of acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal (CID 143435039) is acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal.
What is the SMILES notation for acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal?
The canonical SMILES for acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal is C#C.C/C=C(C=O)\C=C/CCN.
What is the InChIKey of acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal?
The InChIKey is YOPGXETVCWJNOA-UGKAMQEBSA-N. The full InChI is InChI=1S/C8H13NO.C2H2/c1-2-8(7-10)5-3-4-6-9;1-2/h2-3,5,7H,4,6,9H2,1H3;1-2H/b5-3-,8-2+;.
What are the key properties of acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal?
acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal has a molecular weight of 165.24 g/mol, XLogP of 1.29, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(Z,2E)-6-amino-2-ethylidenehex-3-enal is sourced from PubChem (CID 143435039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).