C24H24N5OP — CID 143435129
[4-[[4-(2-methyl-3-propan-2-ylimidazol-4-yl)-5-phosphanylpyrimidin-2-yl]amino]phenyl]-phenylmethanone (PubChem CID 143435129) has the molecular formula C24H24N5OP and a molecular weight of 429.46 g/mol. Its IUPAC name is [4-[[4-(2-methyl-3-propan-2-ylimidazol-4-yl)-5-phosphanylpyrimidin-2-yl]amino]phenyl]-phenylmethanone.
| Compound Name | [4-[[4-(2-methyl-3-propan-2-ylimidazol-4-yl)-5-phosphanylpyrimidin-2-yl]amino]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 143435129 |
| Molecular Formula | C24H24N5OP |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | [4-[[4-(2-methyl-3-propan-2-ylimidazol-4-yl)-5-phosphanylpyrimidin-2-yl]amino]phenyl]-phenylmethanone |
| SMILES | Cc1ncc(-c2nc(Nc3ccc(C(=O)c4ccccc4)cc3)ncc2P)n1C(C)C |
| InChI | InChI=1S/C24H24N5OP/c1-15(2)29-16(3)25-13-20(29)22-21(31)14-26-24(28-22)27-19-11-9-18(10-12-19)23(30)17-7-5-4-6-8-17/h4-15H,31H2,1-3H3,(H,26,27,28) |
| InChIKey | HSDQYFMPIJNRTR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|