About ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine
ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 143435143) has the molecular formula C21H30N4O2
and a molecular weight of 370.50 g/mol. Its IUPAC name is ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 143435143 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | CC.COCCCNC=O.Cc1ccc(-c2nc3nccc(C)c3[nH]2)cc1 |
| InChI | InChI=1S/C14H13N3.C5H11NO2.C2H6/c1-9-3-5-11(6-4-9)13-16-12-10(2)7-8-15-14(12)17-13;1-8-4-2-3-6-5-7;1-2/h3-8H,1-2H3,(H,15,16,17);5H,2-4H2,1H3,(H,6,7);1-2H3 |
| InChIKey | ZPVLLIRSNWCVHM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine?
The IUPAC name of ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine (CID 143435143) is ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine is CC.COCCCNC=O.Cc1ccc(-c2nc3nccc(C)c3[nH]2)cc1.
What is the InChIKey of ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine?
The InChIKey is ZPVLLIRSNWCVHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3.C5H11NO2.C2H6/c1-9-3-5-11(6-4-9)13-16-12-10(2)7-8-15-14(12)17-13;1-8-4-2-3-6-5-7;1-2/h3-8H,1-2H3,(H,15,16,17);5H,2-4H2,1H3,(H,6,7);1-2H3.
What are the key properties of ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine?
ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine has a molecular weight of 370.50 g/mol, XLogP of 4.04, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(3-methoxypropyl)formamide;7-methyl-2-(4-methylphenyl)-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 143435143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).