C22H33FN2O — CID 143435521
1-(3-fluorophenyl)-3-(methylamino)-1-[(5Z,8Z)-3-propan-2-yl-3,4,7,10-tetrahydro-2H-azecin-1-yl]propan-2-ol (PubChem CID 143435521) has the molecular formula C22H33FN2O and a molecular weight of 360.52 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-(methylamino)-1-[(5Z,8Z)-3-propan-2-yl-3,4,7,10-tetrahydro-2H-azecin-1-yl]propan-2-ol.
| Compound Name | 1-(3-fluorophenyl)-3-(methylamino)-1-[(5Z,8Z)-3-propan-2-yl-3,4,7,10-tetrahydro-2H-azecin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 143435521 |
| Molecular Formula | C22H33FN2O |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 1-(3-fluorophenyl)-3-(methylamino)-1-[(5Z,8Z)-3-propan-2-yl-3,4,7,10-tetrahydro-2H-azecin-1-yl]propan-2-ol |
| SMILES | CNCC(O)C(c1cccc(F)c1)N1C/C=C\C/C=C\CC(C(C)C)C1 |
| InChI | InChI=1S/C22H33FN2O/c1-17(2)19-10-7-5-4-6-8-13-25(16-19)22(21(26)15-24-3)18-11-9-12-20(23)14-18/h5-9,11-12,14,17,19,21-22,24,26H,4,10,13,15-16H2,1-3H3/b7-5-,8-6- |
| InChIKey | YSEBLXPCZIVAQC-SFECMWDFSA-N |
| XLogP | 3.93 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|