About (5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one
(5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one (PubChem CID 143435786) has the molecular formula C14H20F2O2
and a molecular weight of 258.31 g/mol. Its IUPAC name is (5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one.
Molecular Properties
| Compound Name | (5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one |
| PubChem CID | 143435786 |
| Molecular Formula | C14H20F2O2 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one |
| SMILES | C=C/C=C(\C=C(\C)COCC(F)F)CCC(C)=O |
| InChI | InChI=1S/C14H20F2O2/c1-4-5-13(7-6-12(3)17)8-11(2)9-18-10-14(15)16/h4-5,8,14H,1,6-7,9-10H2,2-3H3/b11-8-,13-5- |
| InChIKey | GPQQKJMKMUMJCW-ZEEMKOGDSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one?
The IUPAC name of (5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one (CID 143435786) is (5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one.
What is the SMILES notation for (5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one?
The canonical SMILES for (5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one is C=C/C=C(\C=C(\C)COCC(F)F)CCC(C)=O.
What is the InChIKey of (5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one?
The InChIKey is GPQQKJMKMUMJCW-ZEEMKOGDSA-N. The full InChI is InChI=1S/C14H20F2O2/c1-4-5-13(7-6-12(3)17)8-11(2)9-18-10-14(15)16/h4-5,8,14H,1,6-7,9-10H2,2-3H3/b11-8-,13-5-.
What are the key properties of (5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one?
(5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one has a molecular weight of 258.31 g/mol, XLogP of 3.70, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-[(Z)-3-(2,2-difluoroethoxy)-2-methylprop-1-enyl]octa-5,7-dien-2-one is sourced from PubChem (CID 143435786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).