C19H23F3N8O3 — CID 143435827
2-(6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)-N-(2-methoxyethyl)-6-[[(2S)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]amino]pyrimidine-4-carboxamide (PubChem CID 143435827) has the molecular formula C19H23F3N8O3 and a molecular weight of 468.44 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)-N-(2-methoxyethyl)-6-[[(2S)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]amino]pyrimidine-4-carboxamide.
| Compound Name | 2-(6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)-N-(2-methoxyethyl)-6-[[(2S)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]amino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 143435827 |
| Molecular Formula | C19H23F3N8O3 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-(6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)-N-(2-methoxyethyl)-6-[[(2S)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]amino]pyrimidine-4-carboxamide |
| SMILES | COCCNC(=O)c1cc(N[C@@H](C)C(=O)NCC(F)(F)F)nc(C2CNc3ncncc32)n1 |
| InChI | InChI=1S/C19H23F3N8O3/c1-10(17(31)26-8-19(20,21)22)28-14-5-13(18(32)24-3-4-33-2)29-16(30-14)12-7-25-15-11(12)6-23-9-27-15/h5-6,9-10,12H,3-4,7-8H2,1-2H3,(H,24,32)(H,26,31)(H,23,25,27)(H,28,29,30)/t10-,12?/m0/s1 |
| InChIKey | ZCQARCMNUULARC-NUHJPDEHSA-N |
| XLogP | 0.68 |
| TPSA | 143.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|