C10H17NO2 — CID 143435963
(4R,4aR,7S,7aS)-4a-amino-4,7-dimethyl-3,4,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-one (PubChem CID 143435963) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (4R,4aR,7S,7aS)-4a-amino-4,7-dimethyl-3,4,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-one.
| Compound Name | (4R,4aR,7S,7aS)-4a-amino-4,7-dimethyl-3,4,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-one |
|---|---|
| PubChem CID | 143435963 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (4R,4aR,7S,7aS)-4a-amino-4,7-dimethyl-3,4,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-one |
| SMILES | C[C@H]1CC[C@@]2(N)[C@@H](C)COC(=O)[C@@H]12 |
| InChI | InChI=1S/C10H17NO2/c1-6-3-4-10(11)7(2)5-13-9(12)8(6)10/h6-8H,3-5,11H2,1-2H3/t6-,7-,8+,10+/m0/s1 |
| InChIKey | GRMMKGXFCPNIAF-QHOPCYEYSA-N |
| XLogP | 0.92 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |