C26H45NO2 — CID 143436144
2-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2,2-dimethyloxan-4-yl]-N-[(6,6,7-trimethyloxepan-4-yl)methyl]ethanamine (PubChem CID 143436144) has the molecular formula C26H45NO2 and a molecular weight of 403.65 g/mol. Its IUPAC name is 2-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2,2-dimethyloxan-4-yl]-N-[(6,6,7-trimethyloxepan-4-yl)methyl]ethanamine.
| Compound Name | 2-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2,2-dimethyloxan-4-yl]-N-[(6,6,7-trimethyloxepan-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 143436144 |
| Molecular Formula | C26H45NO2 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 403.35 |
| IUPAC Name | 2-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2,2-dimethyloxan-4-yl]-N-[(6,6,7-trimethyloxepan-4-yl)methyl]ethanamine |
| SMILES | C=C/C(=C\C=C/C)C1(CCNCC2CCOC(C)C(C)(C)C2)CCOC(C)(C)C1 |
| InChI | InChI=1S/C26H45NO2/c1-8-10-11-23(9-2)26(14-17-29-25(6,7)20-26)13-15-27-19-22-12-16-28-21(3)24(4,5)18-22/h8-11,21-22,27H,2,12-20H2,1,3-7H3/b10-8-,23-11+ |
| InChIKey | AMFFDDDRGFJFLH-GYVVZKRYSA-N |
| XLogP | 6.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|