C14H25NO — CID 143436287
(2E,4Z)-N-cyclopropyl-2-[(Z)-prop-1-enyl]hexa-2,4-dienamide;ethane;molecular hydrogen (PubChem CID 143436287) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (2E,4Z)-N-cyclopropyl-2-[(Z)-prop-1-enyl]hexa-2,4-dienamide;ethane;molecular hydrogen.
| Compound Name | (2E,4Z)-N-cyclopropyl-2-[(Z)-prop-1-enyl]hexa-2,4-dienamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 143436287 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (2E,4Z)-N-cyclopropyl-2-[(Z)-prop-1-enyl]hexa-2,4-dienamide;ethane;molecular hydrogen |
| SMILES | C/C=C\C=C(/C=C\C)C(=O)NC1CC1.CC.[H][H] |
| InChI | InChI=1S/C12H17NO.C2H6.H2/c1-3-5-7-10(6-4-2)12(14)13-11-8-9-11;1-2;/h3-7,11H,8-9H2,1-2H3,(H,13,14);1-2H3;1H/b5-3-,6-4-,10-7+;; |
| InChIKey | RXZAMAPTOFEIRI-VODCSODSSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|