C22H47NO — CID 143436811
N-(2,3-dimethylcyclohexyl)decanamide;ethane (PubChem CID 143436811) has the molecular formula C22H47NO and a molecular weight of 341.62 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)decanamide;ethane.
| Compound Name | N-(2,3-dimethylcyclohexyl)decanamide;ethane |
|---|---|
| PubChem CID | 143436811 |
| Molecular Formula | C22H47NO |
| Molecular Weight | 341.62 g/mol |
| Exact Mass | 341.37 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)decanamide;ethane |
| SMILES | CC.CC.CCCCCCCCCC(=O)NC1CCCC(C)C1C |
| InChI | InChI=1S/C18H35NO.2C2H6/c1-4-5-6-7-8-9-10-14-18(20)19-17-13-11-12-15(2)16(17)3;2*1-2/h15-17H,4-14H2,1-3H3,(H,19,20);2*1-2H3 |
| InChIKey | XBHPCPSIGOLHNN-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.62 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|