C26H35FN2O4 — CID 143436922
5-[4-[(2-fluorophenyl)methoxy]phenyl]-1-methyl-N-propylpyrrolidine-2-carboxamide;propan-2-yl formate (PubChem CID 143436922) has the molecular formula C26H35FN2O4 and a molecular weight of 458.57 g/mol. Its IUPAC name is 5-[4-[(2-fluorophenyl)methoxy]phenyl]-1-methyl-N-propylpyrrolidine-2-carboxamide;propan-2-yl formate.
| Compound Name | 5-[4-[(2-fluorophenyl)methoxy]phenyl]-1-methyl-N-propylpyrrolidine-2-carboxamide;propan-2-yl formate |
|---|---|
| PubChem CID | 143436922 |
| Molecular Formula | C26H35FN2O4 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 5-[4-[(2-fluorophenyl)methoxy]phenyl]-1-methyl-N-propylpyrrolidine-2-carboxamide;propan-2-yl formate |
| SMILES | CC(C)OC=O.CCCNC(=O)C1CCC(c2ccc(OCc3ccccc3F)cc2)N1C |
| InChI | InChI=1S/C22H27FN2O2.C4H8O2/c1-3-14-24-22(26)21-13-12-20(25(21)2)16-8-10-18(11-9-16)27-15-17-6-4-5-7-19(17)23;1-4(2)6-3-5/h4-11,20-21H,3,12-15H2,1-2H3,(H,24,26);3-4H,1-2H3 |
| InChIKey | UIXUZIHZHLKANN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|