C26H25FN2O2 — CID 143437224
N-cyclopropyl-3-[(4E)-4-[1-(4-fluorophenyl)ethenyl]-5-hydroxyhexa-2,4-dien-3-yl]-1H-indole-6-carboxamide (PubChem CID 143437224) has the molecular formula C26H25FN2O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is N-cyclopropyl-3-[(4E)-4-[1-(4-fluorophenyl)ethenyl]-5-hydroxyhexa-2,4-dien-3-yl]-1H-indole-6-carboxamide.
| Compound Name | N-cyclopropyl-3-[(4E)-4-[1-(4-fluorophenyl)ethenyl]-5-hydroxyhexa-2,4-dien-3-yl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 143437224 |
| Molecular Formula | C26H25FN2O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-cyclopropyl-3-[(4E)-4-[1-(4-fluorophenyl)ethenyl]-5-hydroxyhexa-2,4-dien-3-yl]-1H-indole-6-carboxamide |
| SMILES | C=C(/C(C(=CC)c1c[nH]c2cc(C(=O)NC3CC3)ccc12)=C(/C)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H25FN2O2/c1-4-21(25(16(3)30)15(2)17-5-8-19(27)9-6-17)23-14-28-24-13-18(7-12-22(23)24)26(31)29-20-10-11-20/h4-9,12-14,20,28,30H,2,10-11H2,1,3H3,(H,29,31)/b21-4?,25-16+ |
| InChIKey | SUQHUHGQPDFYOM-HQDBGCEPSA-N |
| XLogP | 6.15 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|