About 4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane
4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane (PubChem CID 143437554) has the molecular formula C18H36N4O2
and a molecular weight of 340.51 g/mol. Its IUPAC name is 4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane |
| PubChem CID | 143437554 |
| Molecular Formula | C18H36N4O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | 4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane |
| SMILES | CN1CCCC2(CNCCO2)C1.CN1CCOC2(CCCNC2)C1 |
| InChI | InChI=1S/2C9H18N2O/c1-11-5-2-3-9(8-11)7-10-4-6-12-9;1-11-5-6-12-9(8-11)3-2-4-10-7-9/h2*10H,2-8H2,1H3 |
| InChIKey | TYPKYWYQHSGITL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane?
The IUPAC name of 4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane (CID 143437554) is 4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane.
What is the SMILES notation for 4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane?
The canonical SMILES for 4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane is CN1CCCC2(CNCCO2)C1.CN1CCOC2(CCCNC2)C1.
What is the InChIKey of 4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane?
The InChIKey is TYPKYWYQHSGITL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H18N2O/c1-11-5-2-3-9(8-11)7-10-4-6-12-9;1-11-5-6-12-9(8-11)3-2-4-10-7-9/h2*10H,2-8H2,1H3.
What are the key properties of 4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane?
4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane has a molecular weight of 340.51 g/mol, XLogP of 0.14, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-oxa-4,8-diazaspiro[5.5]undecane;8-methyl-1-oxa-4,8-diazaspiro[5.5]undecane is sourced from PubChem (CID 143437554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).