About (2Z,4Z)-2-aminohepta-2,4,6-trienal
(2Z,4Z)-2-aminohepta-2,4,6-trienal (PubChem CID 143438033) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is (2Z,4Z)-2-aminohepta-2,4,6-trienal.
Molecular Properties
| Compound Name | (2Z,4Z)-2-aminohepta-2,4,6-trienal |
| PubChem CID | 143438033 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (2Z,4Z)-2-aminohepta-2,4,6-trienal |
| SMILES | C=C/C=C\C=C(/N)C=O |
| InChI | InChI=1S/C7H9NO/c1-2-3-4-5-7(8)6-9/h2-6H,1,8H2/b4-3-,7-5- |
| InChIKey | KNJJWOKIXRMXIT-MRWCJKGFSA-N |
| XLogP | 0.77 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-2-aminohepta-2,4,6-trienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-2-aminohepta-2,4,6-trienal?
The IUPAC name of (2Z,4Z)-2-aminohepta-2,4,6-trienal (CID 143438033) is (2Z,4Z)-2-aminohepta-2,4,6-trienal.
What is the SMILES notation for (2Z,4Z)-2-aminohepta-2,4,6-trienal?
The canonical SMILES for (2Z,4Z)-2-aminohepta-2,4,6-trienal is C=C/C=C\C=C(/N)C=O.
What is the InChIKey of (2Z,4Z)-2-aminohepta-2,4,6-trienal?
The InChIKey is KNJJWOKIXRMXIT-MRWCJKGFSA-N. The full InChI is InChI=1S/C7H9NO/c1-2-3-4-5-7(8)6-9/h2-6H,1,8H2/b4-3-,7-5-.
What are the key properties of (2Z,4Z)-2-aminohepta-2,4,6-trienal?
(2Z,4Z)-2-aminohepta-2,4,6-trienal has a molecular weight of 123.15 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-2-aminohepta-2,4,6-trienal is sourced from PubChem (CID 143438033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).