About 3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane
3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane (PubChem CID 143438952) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is 3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane.
Molecular Properties
| Compound Name | 3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane |
| PubChem CID | 143438952 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane |
| SMILES | C1=CC2=C(C=CC1)SCN2.CC |
| InChI | InChI=1S/C8H9NS.C2H6/c1-2-4-7-8(5-3-1)10-6-9-7;1-2/h2-5,9H,1,6H2;1-2H3 |
| InChIKey | KMQVDHIAJYKFSD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane?
The IUPAC name of 3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane (CID 143438952) is 3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane.
What is the SMILES notation for 3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane?
The canonical SMILES for 3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane is C1=CC2=C(C=CC1)SCN2.CC.
What is the InChIKey of 3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane?
The InChIKey is KMQVDHIAJYKFSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS.C2H6/c1-2-4-7-8(5-3-1)10-6-9-7;1-2/h2-5,9H,1,6H2;1-2H3.
What are the key properties of 3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane?
3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane has a molecular weight of 181.30 g/mol, XLogP of 3.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dihydro-2H-cyclohepta[d][1,3]thiazole;ethane is sourced from PubChem (CID 143438952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).